Products 2708277-92-1
CAS 2708277-92-1 is the registry number for 4-Fluoro-3-methylphenylalanine Hydrochloride. Offered by: TRC. Available pack sizes: 2,5g.
2-amino-3-(4-fluoro-3-methylphenyl)propanoic acid;hydrochloride (CAS 2708277-92-1) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: 2-amino-3-(4-fluoro-3-methylphenyl)propanoic acid;hydrochloride. InChIKey: DLBWFICBUDAUNN-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | 2-amino-3-(4-fluoro-3-methylphenyl)propanoic acid;hydrochloride |
| InChIKey | DLBWFICBUDAUNN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CC(C(=O)O)N)F.Cl |
Computed by PubChem (NCBI)