Products 2708278-51-5
CAS 2708278-51-5 is the registry number for 5-Fluoro-6-Hydroxyquinoline-8-Carboxylic Acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-fluoro-6-hydroxyquinoline-8-carboxylic acid (CAS 2708278-51-5) is a chemical compound with the molecular formula C10H6FNO3 and a molecular weight of 207.16 g/mol. IUPAC name: 5-fluoro-6-hydroxyquinoline-8-carboxylic acid. InChIKey: FIWKLMCHUXKJKD-UHFFFAOYSA-N.
| Molecular formula | C10H6FNO3 |
|---|---|
| Molecular weight | 207.16 g/mol |
| IUPAC name | 5-fluoro-6-hydroxyquinoline-8-carboxylic acid |
| InChIKey | FIWKLMCHUXKJKD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CC(=C2F)O)C(=O)O)N=C1 |
Computed by PubChem (NCBI)