Products 2708286-68-2
CAS 2708286-68-2 appears in our catalog under these names: 6,6-dimethoxy-2-azaspiro[3.3]heptane,oxalic acid, 97%, 97%, 6,6-dimethoxy-2-azaspiro[3.3]heptane,oxalic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
6,6-dimethoxy-2-azaspiro[3.3]heptane;oxalic acid (CAS 2708286-68-2) is a chemical compound with the molecular formula C10H17NO6 and a molecular weight of 247.24 g/mol. IUPAC name: 6,6-dimethoxy-2-azaspiro[3.3]heptane;oxalic acid. InChIKey: XJVZIFCTVKOLPU-UHFFFAOYSA-N.
| Molecular formula | C10H17NO6 |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | 6,6-dimethoxy-2-azaspiro[3.3]heptane;oxalic acid |
| InChIKey | XJVZIFCTVKOLPU-UHFFFAOYSA-N |
| SMILES | COC1(CC2(C1)CNC2)OC.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)