Products 272122-56-2
CAS 272122-56-2 appears in our catalog under these names: Decursidate, Decursidate, 98.08%, Decursidate, 98.0%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 1 mg, 5 mg, 5mg.
[(2S)-2-hydroxy-2-(4-hydroxyphenyl)ethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (CAS 272122-56-2) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: [(2S)-2-hydroxy-2-(4-hydroxyphenyl)ethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate. InChIKey: CLQSQZGNPFWGAE-UOWSJYKBSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | [(2S)-2-hydroxy-2-(4-hydroxyphenyl)ethyl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| InChIKey | CLQSQZGNPFWGAE-UOWSJYKBSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)OC[C@H](C2=CC=C(C=C2)O)O)O |
Computed by PubChem (NCBI)