CAS 2724509-52-6 is the registry number for rac-2-Hydroxy-5-(1-hydroxyacetyl) Benzamide. Offered by: TRC. Available pack sizes: 500mg.
2-hydroxy-5-(1-hydroxyethyl)benzamide (CAS 2724509-52-6) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-hydroxy-5-(1-hydroxyethyl)benzamide. InChIKey: KGHJCNKNXBWDSP-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-hydroxy-5-(1-hydroxyethyl)benzamide |
| InChIKey | KGHJCNKNXBWDSP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)O)C(=O)N)O |
Computed by PubChem (NCBI)