CAS 2725791-00-2 appears in our catalog under these names: 4,8-Dimethylnaphthalen-1-amine hydrochloride, 98%, 4,8-dimethylnaphthalen-1-amine,hydrochloride, 97%, 97%, 4,8-DIMETHYLNAPHTHALEN-1-AMINE HYDROCHLORIDE, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
4,8-dimethylnaphthalen-1-amine;hydrochloride (CAS 2725791-00-2) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: 4,8-dimethylnaphthalen-1-amine;hydrochloride. InChIKey: KCNJYWVWQUCPMH-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | 4,8-dimethylnaphthalen-1-amine;hydrochloride |
| InChIKey | KCNJYWVWQUCPMH-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CC=C2N)C.Cl |
Computed by PubChem (NCBI)