Products 2740415-65-8
CAS 2740415-65-8 is the registry number for rel-tert-Butyl 4-((3R,4R)-4-(methoxycarbonyl)pyrrolidin-3-yl)piperidine-1-carboxylate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Tert-butyl 4-[(3R,4R)-4-methoxycarbonylpyrrolidin-3-yl]piperidine-1-carboxylate (CAS 2740415-65-8) is a chemical compound with the molecular formula C16H28N2O4 and a molecular weight of 312.40 g/mol. IUPAC name: tert-butyl 4-[(3R,4R)-4-methoxycarbonylpyrrolidin-3-yl]piperidine-1-carboxylate. InChIKey: CEOWTEUDRUKGFN-OLZOCXBDSA-N.
| Molecular formula | C16H28N2O4 |
|---|---|
| Molecular weight | 312.40 g/mol |
| IUPAC name | tert-butyl 4-[(3R,4R)-4-methoxycarbonylpyrrolidin-3-yl]piperidine-1-carboxylate |
| InChIKey | CEOWTEUDRUKGFN-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)[C@H]2CNC[C@@H]2C(=O)OC |
Computed by PubChem (NCBI)