Products 2755724-27-5
CAS 2755724-27-5 is the registry number for 2,4'-Difluoro-4,5-dimethoxy-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-fluoro-2-(4-fluorophenyl)-4,5-dimethoxybenzene (CAS 2755724-27-5) is a chemical compound with the molecular formula C14H12F2O2 and a molecular weight of 250.24 g/mol. IUPAC name: 1-fluoro-2-(4-fluorophenyl)-4,5-dimethoxybenzene. InChIKey: HSEFMYJNEYJSPI-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O2 |
|---|---|
| Molecular weight | 250.24 g/mol |
| IUPAC name | 1-fluoro-2-(4-fluorophenyl)-4,5-dimethoxybenzene |
| InChIKey | HSEFMYJNEYJSPI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C2=CC=C(C=C2)F)F)OC |
Computed by PubChem (NCBI)