Products 2757731-97-6
CAS 2757731-97-6 is the registry number for (4-Cyano-2-oxabicyclo[2.1.1]hexan-1-yl)methyl acetate, 98% GC. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-cyano-2-oxabicyclo[2.1.1]hexan-1-yl)methyl acetate (CAS 2757731-97-6) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (4-cyano-2-oxabicyclo[2.1.1]hexan-1-yl)methyl acetate. InChIKey: FORSRHFMUZMVSO-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (4-cyano-2-oxabicyclo[2.1.1]hexan-1-yl)methyl acetate |
| InChIKey | FORSRHFMUZMVSO-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC12CC(C1)(CO2)C#N |
Computed by PubChem (NCBI)