Products 2761920-94-7
CAS 2761920-94-7 is the registry number for 1-((4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)methyl)pyridin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyridin-2-one (CAS 2761920-94-7) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: 1-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyridin-2-one. InChIKey: KWDSEXKLMRAOQH-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO3 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | 1-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyridin-2-one |
| InChIKey | KWDSEXKLMRAOQH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CN2C=CC=CC2=O |
Computed by PubChem (NCBI)