Products 2764729-32-8
CAS 2764729-32-8 is the registry number for N,2-dimethoxy-5-(trifluoromethyl)benzamide, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
N,2-dimethoxy-5-(trifluoromethyl)benzamide (CAS 2764729-32-8) is a chemical compound with the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. IUPAC name: N,2-dimethoxy-5-(trifluoromethyl)benzamide. InChIKey: ZJBQPRUFGSQIOW-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO3 |
|---|---|
| Molecular weight | 249.19 g/mol |
| IUPAC name | N,2-dimethoxy-5-(trifluoromethyl)benzamide |
| InChIKey | ZJBQPRUFGSQIOW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)C(=O)NOC |
Computed by PubChem (NCBI)