Products 2765161-53-1

CAS 2765161-53-1 is the registry number for Nintedanib Impurity 82. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Dimethyl 2-(2-amino-4-methoxycarbonylphenyl)propanedioate (CAS 2765161-53-1) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: dimethyl 2-(2-amino-4-methoxycarbonylphenyl)propanedioate. InChIKey: IUGOGFPJOHVQJP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO6
Molecular weight281.26 g/mol
IUPAC namedimethyl 2-(2-amino-4-methoxycarbonylphenyl)propanedioate
InChIKeyIUGOGFPJOHVQJP-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1)C(C(=O)OC)C(=O)OC)N

Computed by PubChem (NCBI)