CAS 2765161-53-1 is the registry number for Nintedanib Impurity 82. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 2-(2-amino-4-methoxycarbonylphenyl)propanedioate (CAS 2765161-53-1) is a chemical compound with the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. IUPAC name: dimethyl 2-(2-amino-4-methoxycarbonylphenyl)propanedioate. InChIKey: IUGOGFPJOHVQJP-UHFFFAOYSA-N.
| Molecular formula | C13H15NO6 |
|---|---|
| Molecular weight | 281.26 g/mol |
| IUPAC name | dimethyl 2-(2-amino-4-methoxycarbonylphenyl)propanedioate |
| InChIKey | IUGOGFPJOHVQJP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)C(C(=O)OC)C(=O)OC)N |
Computed by PubChem (NCBI)