cas: 27687-14-5 — see every product listed under this CAS number, including other names
trans-4-N-Boc-Aminomethyl-cyclohexanecarboxylic acid, 97% (CAS 27687-14-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048436-5G |
| cas | 27687-14-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 216.61 Pln | |
| Fluorochem | 25g | 404.04 Pln | |
| Fluorochem | 100g | 1221.46 Pln | |
| Fluorochem | 500g | 5886.49 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid (CAS 27687-14-5) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid. InChIKey: AZEKNJGFCSHZID-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexane-1-carboxylic acid |
| InChIKey | AZEKNJGFCSHZID-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(CC1)C(=O)O |
Computed by PubChem (NCBI)