Products 277296-09-0
CAS 277296-09-0 appears in our catalog under these names: 3-(3,4-Difluorophenyl)morpholine (hydrochloride), 95%, 95%, 3-(3,4-Difluorophenyl)morpholine (hydrochloride), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
3-(3,4-difluorophenyl)morpholine;hydrochloride (CAS 277296-09-0) is a chemical compound with the molecular formula C10H12ClF2NO and a molecular weight of 235.66 g/mol. IUPAC name: 3-(3,4-difluorophenyl)morpholine;hydrochloride. InChIKey: BPAVPVNZRRJRLA-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2NO |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 3-(3,4-difluorophenyl)morpholine;hydrochloride |
| InChIKey | BPAVPVNZRRJRLA-UHFFFAOYSA-N |
| SMILES | C1COCC(N1)C2=CC(=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)