CAS 2648962-48-3 is the registry number for 4-(Methoxymethyl)-2-azabicyclo[2.1.1]hexane-1-carboxylic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(methoxymethyl)-2-azabicyclo[2.1.1]hexane-1-carboxylic acid;hydrochloride (CAS 2648962-48-3) is a chemical compound with the molecular formula C8H14ClNO3 and a molecular weight of 207.65 g/mol. IUPAC name: 4-(methoxymethyl)-2-azabicyclo[2.1.1]hexane-1-carboxylic acid;hydrochloride. InChIKey: CFLNSEWMMBMBTB-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNO3 |
|---|---|
| Molecular weight | 207.65 g/mol |
| IUPAC name | 4-(methoxymethyl)-2-azabicyclo[2.1.1]hexane-1-carboxylic acid;hydrochloride |
| InChIKey | CFLNSEWMMBMBTB-UHFFFAOYSA-N |
| SMILES | COCC12CC(C1)(NC2)C(=O)O.Cl |
Computed by PubChem (NCBI)