CAS 2789-92-6 appears in our catalog under these names: 2-Amino-3,5-Dichlorobenzoic Acid, 2–Amino–3,5–dichlorobenzoic acid, 2-Amino-3,5-dichlorobenzoic Acid, >97.0%(HPLC)(T), 2-Amino-3,5-dichlorobenzoic acid 98%, 3,5-Dichloroanthranilic acid, 96%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 10g, 1g, 50g, 100g, 500g, 250g, 5g, 25g.
2-amino-3,5-dichlorobenzoic acid (CAS 2789-92-6) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 2-amino-3,5-dichlorobenzoic acid. InChIKey: KTHTXLUIEAIGCD-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 2-amino-3,5-dichlorobenzoic acid |
| InChIKey | KTHTXLUIEAIGCD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)Cl)Cl |
Computed by PubChem (NCBI)