Products 1428330-92-0

CAS 1428330-92-0 is the registry number for H-L-Lys(Cyc)-OH*HCl. Offered by: Iris Biotech. Available pack sizes: 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(2S)-2-amino-6-(cyclopentyloxycarbonylamino)hexanoic acid;hydrochloride (CAS 1428330-92-0) is a chemical compound with the molecular formula C12H23ClN2O4 and a molecular weight of 294.77 g/mol. IUPAC name: (2S)-2-amino-6-(cyclopentyloxycarbonylamino)hexanoic acid;hydrochloride. InChIKey: JIUUJVSPXXHPSF-PPHPATTJSA-N.

Identity
Molecular formulaC12H23ClN2O4
Molecular weight294.77 g/mol
IUPAC name(2S)-2-amino-6-(cyclopentyloxycarbonylamino)hexanoic acid;hydrochloride
InChIKeyJIUUJVSPXXHPSF-PPHPATTJSA-N
SMILESC1CCC(C1)OC(=O)NCCCC[C@@H](C(=O)O)N.Cl

Computed by PubChem (NCBI)