CAS 70601-62-6 appears in our catalog under these names: Ac-d-tyr(mE)-oh, 95%, (r)-2-Acetamido-3-(4-methoxyphenyl)propanoic acid, 98%, 98%, (r)-2-Acetamido-3-(4-methoxyphenyl)propanoic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
(2R)-2-acetamido-3-(4-methoxyphenyl)propanoic acid (CAS 70601-62-6) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2R)-2-acetamido-3-(4-methoxyphenyl)propanoic acid. InChIKey: HRUASHPCEMXOMR-LLVKDONJSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(4-methoxyphenyl)propanoic acid |
| InChIKey | HRUASHPCEMXOMR-LLVKDONJSA-N |
| SMILES | CC(=O)N[C@H](CC1=CC=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)