Products 2825005-05-6
CAS 2825005-05-6 is the registry number for 5-Bromo-4-fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
5-bromo-4-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 2825005-05-6) is a chemical compound with the molecular formula C9H10BrClFN and a molecular weight of 266.54 g/mol. IUPAC name: 5-bromo-4-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: YEZPDQHJLCVYGM-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClFN |
|---|---|
| Molecular weight | 266.54 g/mol |
| IUPAC name | 5-bromo-4-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | YEZPDQHJLCVYGM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=CC(=C2F)Br.Cl |
Computed by PubChem (NCBI)