CAS 2044901-42-8 appears in our catalog under these names: 8-Bromo-7-fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 8-Bromo-7-fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
8-bromo-7-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 2044901-42-8) is a chemical compound with the molecular formula C9H10BrClFN and a molecular weight of 266.54 g/mol. IUPAC name: 8-bromo-7-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: SIHJVWXXQGOBEQ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClFN |
|---|---|
| Molecular weight | 266.54 g/mol |
| IUPAC name | 8-bromo-7-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | SIHJVWXXQGOBEQ-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C=CC(=C2Br)F.Cl |
Computed by PubChem (NCBI)