CAS 1432679-94-1 appears in our catalog under these names: 6-Bromo-8-fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 98+%, 6-Bromo-8-fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 0,5g, 50mg.
6-bromo-8-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 1432679-94-1) is a chemical compound with the molecular formula C9H10BrClFN and a molecular weight of 266.54 g/mol. IUPAC name: 6-bromo-8-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: YXMGIICHJFYOAG-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClFN |
|---|---|
| Molecular weight | 266.54 g/mol |
| IUPAC name | 6-bromo-8-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | YXMGIICHJFYOAG-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C=C(C=C2F)Br.Cl |
Computed by PubChem (NCBI)