Products 1864056-09-6
CAS 1864056-09-6 appears in our catalog under these names: 4-bromo-5-fluoro-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, 4-Bromo-5-fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-bromo-5-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1864056-09-6) is a chemical compound with the molecular formula C9H10BrClFN and a molecular weight of 266.54 g/mol. IUPAC name: 4-bromo-5-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: XNAROOZBFIIWHS-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClFN |
|---|---|
| Molecular weight | 266.54 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | XNAROOZBFIIWHS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=CC(=C2Br)F.Cl |
Computed by PubChem (NCBI)