CAS 1235439-87-8 appears in our catalog under these names: 6-Bromo-8-fluoro-1,2,3,4-tetrahydroquinoline hydrochloride, 6-Bromo-8-fluoro-1,2,3,4-tetrahydroquinoline hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
6-bromo-8-fluoro-1,2,3,4-tetrahydroquinoline;hydrochloride (CAS 1235439-87-8) is a chemical compound with the molecular formula C9H10BrClFN and a molecular weight of 266.54 g/mol. IUPAC name: 6-bromo-8-fluoro-1,2,3,4-tetrahydroquinoline;hydrochloride. InChIKey: SAYHINNJNGVRQX-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClFN |
|---|---|
| Molecular weight | 266.54 g/mol |
| IUPAC name | 6-bromo-8-fluoro-1,2,3,4-tetrahydroquinoline;hydrochloride |
| InChIKey | SAYHINNJNGVRQX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)Br)F)NC1.Cl |
Computed by PubChem (NCBI)