CAS 1233526-84-5 appears in our catalog under these names: 7-Bromo-6-fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 98%, 7-Bromo-6-fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
7-bromo-6-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 1233526-84-5) is a chemical compound with the molecular formula C9H10BrClFN and a molecular weight of 266.54 g/mol. IUPAC name: 7-bromo-6-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: LBQAEXDXEDDFLV-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClFN |
|---|---|
| Molecular weight | 266.54 g/mol |
| IUPAC name | 7-bromo-6-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | LBQAEXDXEDDFLV-UHFFFAOYSA-N |
| SMILES | C1CNCC2=CC(=C(C=C21)F)Br.Cl |
Computed by PubChem (NCBI)