CAS 2241141-57-9 is the registry number for 5-Bromo-7-fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-7-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 2241141-57-9) is a chemical compound with the molecular formula C9H10BrClFN and a molecular weight of 266.54 g/mol. IUPAC name: 5-bromo-7-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: HZILVHDYAFWCPP-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClFN |
|---|---|
| Molecular weight | 266.54 g/mol |
| IUPAC name | 5-bromo-7-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | HZILVHDYAFWCPP-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C(=CC(=C2)F)Br.Cl |
Computed by PubChem (NCBI)