CAS 1820581-01-8 appears in our catalog under these names: (1R,2S)-2-(4-Bromo-3-fluorophenyl)cyclopropan-1-amine hydrochloride, 98%, (1R,2S)-2-(4-bromo-3-fluoro-phenyl)cyclopropanamine,hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg.
Trans-(1R,2S)-2-(4-bromo-3-fluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1820581-01-8) is a chemical compound with the molecular formula C9H10BrClFN and a molecular weight of 266.54 g/mol. IUPAC name: trans-(1R,2S)-2-(4-bromo-3-fluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: DDRQDHZQDJJSCB-RDNZEXAOSA-N.
| Molecular formula | C9H10BrClFN |
|---|---|
| Molecular weight | 266.54 g/mol |
| IUPAC name | trans-(1R,2S)-2-(4-bromo-3-fluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | DDRQDHZQDJJSCB-RDNZEXAOSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC(=C(C=C2)Br)F.Cl |
Computed by PubChem (NCBI)