Products 282524-94-1

CAS 282524-94-1 is the registry number for 3-(Fmoc-NH)-hexanoic acid. Offered by: Iris Biotech. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 282524-94-1) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: VQAFHGLNHSVMSP-UHFFFAOYSA-N.

Identity
Molecular formulaC21H23NO4
Molecular weight353.4 g/mol
IUPAC name3-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid
InChIKeyVQAFHGLNHSVMSP-UHFFFAOYSA-N
SMILESCCCC(CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)