CAS 2829292-56-8 appears in our catalog under these names: (R)-2-Amino-2-(2-hydroxyphenyl)acetic acid hydrochloride, 95%, 95%, H-D-Phg(2-OH)-OH HCl, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-amino-2-(2-hydroxyphenyl)acetic acid;hydrochloride (CAS 2829292-56-8) is a chemical compound with the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. IUPAC name: (2R)-2-amino-2-(2-hydroxyphenyl)acetic acid;hydrochloride. InChIKey: DAQIOEDLFVEAKH-OGFXRTJISA-N.
| Molecular formula | C8H10ClNO3 |
|---|---|
| Molecular weight | 203.62 g/mol |
| IUPAC name | (2R)-2-amino-2-(2-hydroxyphenyl)acetic acid;hydrochloride |
| InChIKey | DAQIOEDLFVEAKH-OGFXRTJISA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](C(=O)O)N)O.Cl |
Computed by PubChem (NCBI)