Products 2832888-25-0
CAS 2832888-25-0 is the registry number for 1-(tert-Butyl) 2-ethyl (2S,4S)-4-aminopyrrolidine-1,2-dicarboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-O-tert-butyl 2-O-ethyl (2S,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride (CAS 2832888-25-0) is a chemical compound with the molecular formula C12H23ClN2O4 and a molecular weight of 294.77 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl (2S,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride. InChIKey: XXNJZPMLIFHXRE-OZZZDHQUSA-N.
| Molecular formula | C12H23ClN2O4 |
|---|---|
| Molecular weight | 294.77 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl (2S,4S)-4-aminopyrrolidine-1,2-dicarboxylate;hydrochloride |
| InChIKey | XXNJZPMLIFHXRE-OZZZDHQUSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](CN1C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)