CAS 2835-69-0 appears in our catalog under these names: Biphenyl-2,4,4'-triamine, 95%, Biphenyl-2,4,4'-triamine, [1,1'-Biphenyl]-2,4,4'-triamine 97%, Biphenyl-2,4,4'-triamine, 97%, 97%. Offered by: Combi-blocks, TRC, Ambeed, Chemat. Available pack sizes: 1g, 5g, 2,5g, 100mg, 250mg.
4-(4-aminophenyl)benzene-1,3-diamine (CAS 2835-69-0) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 4-(4-aminophenyl)benzene-1,3-diamine. InChIKey: GMJHZZCVWDJKFB-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 4-(4-aminophenyl)benzene-1,3-diamine |
| InChIKey | GMJHZZCVWDJKFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)N)N)N |
Computed by PubChem (NCBI)