Products 2849331-70-8
CAS 2849331-70-8 is the registry number for 2-(4-(1-(Difluoromethyl)cyclopropyl)phenyl)acetic acid, 98%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 50mg, 100mg.
2-[4-[1-(difluoromethyl)cyclopropyl]phenyl]acetic acid (CAS 2849331-70-8) is a chemical compound with the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. IUPAC name: 2-[4-[1-(difluoromethyl)cyclopropyl]phenyl]acetic acid. InChIKey: YMGCQRRAAKQXHT-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O2 |
|---|---|
| Molecular weight | 226.22 g/mol |
| IUPAC name | 2-[4-[1-(difluoromethyl)cyclopropyl]phenyl]acetic acid |
| InChIKey | YMGCQRRAAKQXHT-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)CC(=O)O)C(F)F |
Computed by PubChem (NCBI)