CAS 2851484-77-8 is the registry number for Dimethyl 5-bromo-4-methylisophthalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 5-bromo-4-methylbenzene-1,3-dicarboxylate (CAS 2851484-77-8) is a chemical compound with the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. IUPAC name: dimethyl 5-bromo-4-methylbenzene-1,3-dicarboxylate. InChIKey: UZYZMPUPMBLWAZ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO4 |
|---|---|
| Molecular weight | 287.11 g/mol |
| IUPAC name | dimethyl 5-bromo-4-methylbenzene-1,3-dicarboxylate |
| InChIKey | UZYZMPUPMBLWAZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Br)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)