Products 28544-42-5
CAS 28544-42-5 appears in our catalog under these names: 2-(Methylamino)-2-phenylacetic acid hydrochloride, 98%, alpha-(Methylamino)benzeneacetic acid HCl. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 2,5g.
2-(methylamino)-2-phenylacetic acid;hydrochloride (CAS 28544-42-5) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: 2-(methylamino)-2-phenylacetic acid;hydrochloride. InChIKey: FUUXTVBJBBSPAG-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | 2-(methylamino)-2-phenylacetic acid;hydrochloride |
| InChIKey | FUUXTVBJBBSPAG-UHFFFAOYSA-N |
| SMILES | CNC(C1=CC=CC=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(methylamino)-2-phenylacetic acid hydrochloride, 2-(Methylamino)-2-phenylacetic acid HCl, N-ME-DL-PHG-OH, 2-(methylamino)-2-phenylacetic acid;hydrochloride, alpha-(Methylamino)benzeneacetic acid HCl, (S)-a-(Methylamino)benzeneacetic acid hydrochloride, (R)-a-(Methylamino)-benzeneacetic acid hydrochloride, 2-(Methylamino)-2-phenylaceticacidhydrochloride, a-(Methylamino)benzeneacetic acid hydrochloride, 2-(methylamino)-2-phenyl-acetic acid;hydrochloride