Products 4418-82-0
CAS 4418-82-0 is the registry number for (S)-2-(Methylamino)-2-phenylacetic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(methylamino)-2-phenylacetic acid;hydrochloride (CAS 4418-82-0) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: (2S)-2-(methylamino)-2-phenylacetic acid;hydrochloride. InChIKey: FUUXTVBJBBSPAG-QRPNPIFTSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | (2S)-2-(methylamino)-2-phenylacetic acid;hydrochloride |
| InChIKey | FUUXTVBJBBSPAG-QRPNPIFTSA-N |
| SMILES | CN[C@@H](C1=CC=CC=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-2-(Methylamino)-2-phenylacetic acid hydrochloride, (S)-alpha-(Methylamino)benzeneacetic acid HCl, (S)-a-(Methylamino)benzeneacetic acid hydrochloride, (2S)-2-(methylamino)-2-phenyl-acetic acid;hydrochloride, (2S)-2-(methylamino)-2-phenylacetic acid;hydrochloride, N-alpha-Methyl-L-phenylglycine hydrochloride (Me-L-Phg-OH.HCl)