CAS 286411-22-1 is the registry number for 7-Methoxy-1,8-naphthyridin-4-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methoxy-1H-1,8-naphthyridin-4-one (CAS 286411-22-1) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 7-methoxy-1H-1,8-naphthyridin-4-one. InChIKey: YKLVNVPLNYIFCF-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 7-methoxy-1H-1,8-naphthyridin-4-one |
| InChIKey | YKLVNVPLNYIFCF-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)C(=O)C=CN2 |
Computed by PubChem (NCBI)