CAS 286456-64-2 appears in our catalog under these names: 5-Oxo-4-azatricyclo(4.2.1.0,3,7)nonane-3-carboxylic acid, 98%, 5-Oxo-4-azatricyclo(4.2.1.0,3,7)nonane-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-oxo-4-azatricyclo[4.2.1.03,7]nonane-3-carboxylic acid (CAS 286456-64-2) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 5-oxo-4-azatricyclo[4.2.1.03,7]nonane-3-carboxylic acid. InChIKey: PBJDFNRYWNIDJL-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 5-oxo-4-azatricyclo[4.2.1.03,7]nonane-3-carboxylic acid |
| InChIKey | PBJDFNRYWNIDJL-UHFFFAOYSA-N |
| SMILES | C1C2CC3C1C(=O)NC3(C2)C(=O)O |
Computed by PubChem (NCBI)