CAS 28669-17-2 appears in our catalog under these names: 2-Phenyl-4h-1,3,4-oxadiazin-5(6h)-one, 95%, 2-Phenyl-5,6-dihydro-4H-1,3,4-oxadiazin-5-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-phenyl-4H-1,3,4-oxadiazin-5-one (CAS 28669-17-2) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 2-phenyl-4H-1,3,4-oxadiazin-5-one. InChIKey: BKHCFFMTBGZSIR-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-phenyl-4H-1,3,4-oxadiazin-5-one |
| InChIKey | BKHCFFMTBGZSIR-UHFFFAOYSA-N |
| SMILES | C1C(=O)NN=C(O1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)