Products 38489-70-2
CAS 38489-70-2 is the registry number for (E)-2,3-(Methylenedioxy)cinnamic acid. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg.
(E)-3-(1,3-benzodioxol-4-yl)prop-2-enoic acid (CAS 38489-70-2) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: (E)-3-(1,3-benzodioxol-4-yl)prop-2-enoic acid. InChIKey: NWSIULATLGKZGF-SNAWJCMRSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | (E)-3-(1,3-benzodioxol-4-yl)prop-2-enoic acid |
| InChIKey | NWSIULATLGKZGF-SNAWJCMRSA-N |
| SMILES | C1OC2=CC=CC(=C2O1)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2E)-3-(2H-1,3-Benzodioxol-4-yl)prop-2-enoic acid, E, (e)-3-(benzo[d][1,3]dioxol-4-yl)acrylic acid, (2E)-3-(1,3-dioxaindan-4-yl)prop-2-enoic acid, (E)-3-(1,3-benzodioxol-4-yl)prop-2-enoic acid, 2,3-methylenedioxycinnamic acid, 3-(Benzo[d][1,3]dioxol-4-yl)acrylic acid, (E)-2,3-(Methylenedioxy)cinnamic acid, 3-(1,3-dioxaindan-4-yl)prop-2-enoic acid, (E)-3-(Benzo[d][1,3]dioxol-4-yl)-2-propenoic acid