CAS 2882097-31-4 is the registry number for STING agonist-43. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 2-(2-methoxy-3,4,7-trimethyl-9-oxoacridin-10-yl)acetate (CAS 2882097-31-4) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: ethyl 2-(2-methoxy-3,4,7-trimethyl-9-oxoacridin-10-yl)acetate. InChIKey: BGSVOROMEUZHGP-UHFFFAOYSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | ethyl 2-(2-methoxy-3,4,7-trimethyl-9-oxoacridin-10-yl)acetate |
| InChIKey | BGSVOROMEUZHGP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C2=C(C=C(C=C2)C)C(=O)C3=CC(=C(C(=C31)C)C)OC |
Computed by PubChem (NCBI)