CAS 28918-95-8 appears in our catalog under these names: 6-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl acetate, 96%, 96%, 6-Methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl acetate, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl) acetate (CAS 28918-95-8) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: (6-methyl-2,4-dioxo-1H-pyrimidin-5-yl) acetate. InChIKey: PAPNVSLHAZOKFY-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | (6-methyl-2,4-dioxo-1H-pyrimidin-5-yl) acetate |
| InChIKey | PAPNVSLHAZOKFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)NC(=O)N1)OC(=O)C |
Computed by PubChem (NCBI)