CAS 2901066-51-9 is the registry number for 2-Bromo-1,3-difluoro-5-isopropoxybenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-1,3-difluoro-5-propan-2-yloxybenzene (CAS 2901066-51-9) is a chemical compound with the molecular formula C9H9BrF2O and a molecular weight of 251.07 g/mol. IUPAC name: 2-bromo-1,3-difluoro-5-propan-2-yloxybenzene. InChIKey: YGYLDAOXWJPZMB-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF2O |
|---|---|
| Molecular weight | 251.07 g/mol |
| IUPAC name | 2-bromo-1,3-difluoro-5-propan-2-yloxybenzene |
| InChIKey | YGYLDAOXWJPZMB-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C(=C1)F)Br)F |
Computed by PubChem (NCBI)