Products 2901095-84-7
CAS 2901095-84-7 is the registry number for 4-(2,3-dichloropyridin-4-yl)tetrahydro-2H-pyran-4-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2,3-dichloro-4-pyridinyl)oxan-4-ol (CAS 2901095-84-7) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: 4-(2,3-dichloro-4-pyridinyl)oxan-4-ol. InChIKey: PTZFRXVEYQIPRG-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 4-(2,3-dichloro-4-pyridinyl)oxan-4-ol |
| InChIKey | PTZFRXVEYQIPRG-UHFFFAOYSA-N |
| SMILES | C1COCCC1(C2=C(C(=NC=C2)Cl)Cl)O |
Computed by PubChem (NCBI)