Products 2901098-78-8
CAS 2901098-78-8 is the registry number for 1-(2,6-Dichloro-3-methoxyphenyl)propan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,6-dichloro-3-methoxyphenyl)propan-1-ol (CAS 2901098-78-8) is a chemical compound with the molecular formula C10H12Cl2O2 and a molecular weight of 235.10 g/mol. IUPAC name: 1-(2,6-dichloro-3-methoxyphenyl)propan-1-ol. InChIKey: RBHUNYDFXARRTR-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2O2 |
|---|---|
| Molecular weight | 235.10 g/mol |
| IUPAC name | 1-(2,6-dichloro-3-methoxyphenyl)propan-1-ol |
| InChIKey | RBHUNYDFXARRTR-UHFFFAOYSA-N |
| SMILES | CCC(C1=C(C=CC(=C1Cl)OC)Cl)O |
Computed by PubChem (NCBI)