CAS 29100-83-2 is the registry number for Maturone. Offered by: Chemat Brand. Available pack sizes: on request.
3-(hydroxymethyl)-5-methylbenzo[f][1]benzofuran-4,9-dione (CAS 29100-83-2) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 3-(hydroxymethyl)-5-methylbenzo[f][1]benzofuran-4,9-dione. InChIKey: KDAMTLGCZPUMAR-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 3-(hydroxymethyl)-5-methylbenzo[f][1]benzofuran-4,9-dione |
| InChIKey | KDAMTLGCZPUMAR-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)C3=C(C2=O)C(=CO3)CO |
Computed by PubChem (NCBI)