Products 2918815-88-8
CAS 2918815-88-8 is the registry number for Methyl 2-chloro-6-(2-methoxy-2-oxoethyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-chloro-6-(2-methoxy-2-oxoethyl)benzoate (CAS 2918815-88-8) is a chemical compound with the molecular formula C11H11ClO4 and a molecular weight of 242.65 g/mol. IUPAC name: methyl 2-chloro-6-(2-methoxy-2-oxoethyl)benzoate. InChIKey: KBRWDDCHWUVUCG-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4 |
|---|---|
| Molecular weight | 242.65 g/mol |
| IUPAC name | methyl 2-chloro-6-(2-methoxy-2-oxoethyl)benzoate |
| InChIKey | KBRWDDCHWUVUCG-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C(=CC=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)