CAS 2918848-69-6 is the registry number for 2-(3-bromo-2-isopropoxy-5-methylphenyl)-1,3-dioxolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(3-bromo-5-methyl-2-propan-2-yloxyphenyl)-1,3-dioxolane (CAS 2918848-69-6) is a chemical compound with the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. IUPAC name: 2-(3-bromo-5-methyl-2-propan-2-yloxyphenyl)-1,3-dioxolane. InChIKey: MSRQMNCDAZIEPV-UHFFFAOYSA-N.
| Molecular formula | C13H17BrO3 |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | 2-(3-bromo-5-methyl-2-propan-2-yloxyphenyl)-1,3-dioxolane |
| InChIKey | MSRQMNCDAZIEPV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)OC(C)C)C2OCCO2 |
Computed by PubChem (NCBI)