Products 2918959-74-5
CAS 2918959-74-5 is the registry number for 5-Methyl-[1,1'-biphenyl]-2,3'-dicarbaldehyde, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(3-formylphenyl)-4-methylbenzaldehyde (CAS 2918959-74-5) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: 2-(3-formylphenyl)-4-methylbenzaldehyde. InChIKey: RJCOLZZIZSFVRX-UHFFFAOYSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 2-(3-formylphenyl)-4-methylbenzaldehyde |
| InChIKey | RJCOLZZIZSFVRX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C=O)C2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)