Products 2918960-84-4
CAS 2918960-84-4 is the registry number for 1-(3-bromo-2-fluoro-5-methylphenyl)-2-fluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(3-bromo-2-fluoro-5-methylphenyl)-2-fluoroethanone (CAS 2918960-84-4) is a chemical compound with the molecular formula C9H7BrF2O and a molecular weight of 249.05 g/mol. IUPAC name: 1-(3-bromo-2-fluoro-5-methylphenyl)-2-fluoroethanone. InChIKey: MYNQQFLNWASPFK-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O |
|---|---|
| Molecular weight | 249.05 g/mol |
| IUPAC name | 1-(3-bromo-2-fluoro-5-methylphenyl)-2-fluoroethanone |
| InChIKey | MYNQQFLNWASPFK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)F)C(=O)CF |
Computed by PubChem (NCBI)