Products 2921742-42-7
CAS 2921742-42-7 is the registry number for 5-bromo-2,6-dichloronicotinic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-2,6-dichloropyridine-3-carboxylic acid (CAS 2921742-42-7) is a chemical compound with the molecular formula C6H2BrCl2NO2 and a molecular weight of 270.89 g/mol. IUPAC name: 5-bromo-2,6-dichloropyridine-3-carboxylic acid. InChIKey: FDOHCWVNZJUJQZ-UHFFFAOYSA-N.
| Molecular formula | C6H2BrCl2NO2 |
|---|---|
| Molecular weight | 270.89 g/mol |
| IUPAC name | 5-bromo-2,6-dichloropyridine-3-carboxylic acid |
| InChIKey | FDOHCWVNZJUJQZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Br)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-bromo-2,6-dichloronicotinic acid