Products 2921852-40-4
CAS 2921852-40-4 is the registry number for 2-(2,6-dibromo-4-methoxyphenyl)-1,3-dioxolane, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2,6-dibromo-4-methoxyphenyl)-1,3-dioxolane (CAS 2921852-40-4) is a chemical compound with the molecular formula C10H10Br2O3 and a molecular weight of 337.99 g/mol. IUPAC name: 2-(2,6-dibromo-4-methoxyphenyl)-1,3-dioxolane. InChIKey: MJJKRXBFWKJMDR-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O3 |
|---|---|
| Molecular weight | 337.99 g/mol |
| IUPAC name | 2-(2,6-dibromo-4-methoxyphenyl)-1,3-dioxolane |
| InChIKey | MJJKRXBFWKJMDR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)C2OCCO2)Br |
Computed by PubChem (NCBI)